C22H35N3O6 — CID 170570417
4-[(E)-2-aminoethenyl]-N-[2-[2-[2-[2-(pentanoylamino)ethylperoxy]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 170570417) has the molecular formula C22H35N3O6 and a molecular weight of 437.54 g/mol. Its IUPAC name is 4-[(E)-2-aminoethenyl]-N-[2-[2-[2-[2-(pentanoylamino)ethylperoxy]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | 4-[(E)-2-aminoethenyl]-N-[2-[2-[2-[2-(pentanoylamino)ethylperoxy]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 170570417 |
| Molecular Formula | C22H35N3O6 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 4-[(E)-2-aminoethenyl]-N-[2-[2-[2-[2-(pentanoylamino)ethylperoxy]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | CCCCC(=O)NCCOOCCOCCOCCNC(=O)c1ccc(/C=C/N)cc1 |
| InChI | InChI=1S/C22H35N3O6/c1-2-3-4-21(26)24-12-14-30-31-18-17-29-16-15-28-13-11-25-22(27)20-7-5-19(6-8-20)9-10-23/h5-10H,2-4,11-18,23H2,1H3,(H,24,26)(H,25,27)/b10-9+ |
| InChIKey | BWKQBNSVYGDUBU-MDZDMXLPSA-N |
| XLogP | 1.63 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|