C34H56N4O5 — CID 171841525
ethanimidoyl 4-[2-[2-[2-[[(Z)-octadec-9-enoyl]amino]ethoxy]ethoxy]ethylcarbamoyl]benzenecarboximidate (PubChem CID 171841525) has the molecular formula C34H56N4O5 and a molecular weight of 600.85 g/mol. Its IUPAC name is ethanimidoyl 4-[2-[2-[2-[[(Z)-octadec-9-enoyl]amino]ethoxy]ethoxy]ethylcarbamoyl]benzenecarboximidate.
| Compound Name | ethanimidoyl 4-[2-[2-[2-[[(Z)-octadec-9-enoyl]amino]ethoxy]ethoxy]ethylcarbamoyl]benzenecarboximidate |
|---|---|
| PubChem CID | 171841525 |
| Molecular Formula | C34H56N4O5 |
| Molecular Weight | 600.85 g/mol |
| Exact Mass | 600.43 |
| IUPAC Name | ethanimidoyl 4-[2-[2-[2-[[(Z)-octadec-9-enoyl]amino]ethoxy]ethoxy]ethylcarbamoyl]benzenecarboximidate |
| SMILES | [H]/N=C(\O/C(C)=N/[H])c1ccc(C(=O)NCCOCCOCCNC(=O)CCCCCCC/C=C\CCCCCCCC)cc1 |
| InChI | InChI=1S/C34H56N4O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-32(39)37-23-25-41-27-28-42-26-24-38-34(40)31-21-19-30(20-22-31)33(36)43-29(2)35/h10-11,19-22,35-36H,3-9,12-18,23-28H2,1-2H3,(H,37,39)(H,38,40)/b11-10-,35-29+,36-33- |
| InChIKey | UCUXFPLONSKWIA-ABLMGANQSA-N |
| XLogP | 6.94 |
| TPSA | 133.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.85 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|