C28H28N2O5 — CID 158424039
2-ethyl-4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propylcarbamoyl]benzoic acid (PubChem CID 158424039) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is 2-ethyl-4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propylcarbamoyl]benzoic acid.
| Compound Name | 2-ethyl-4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 158424039 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 2-ethyl-4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propylcarbamoyl]benzoic acid |
| SMILES | CCc1cc(C(=O)NCCCNC(=O)OCC2c3ccccc3-c3ccccc32)ccc1C(=O)O |
| InChI | InChI=1S/C28H28N2O5/c1-2-18-16-19(12-13-20(18)27(32)33)26(31)29-14-7-15-30-28(34)35-17-25-23-10-5-3-8-21(23)22-9-4-6-11-24(22)25/h3-6,8-13,16,25H,2,7,14-15,17H2,1H3,(H,29,31)(H,30,34)(H,32,33) |
| InChIKey | MHANFWOINZQYFA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|