C32H36N4O9 — CID 167617428
[2-[4-(2-azidoethoxy)butanoyl]-7-(4-propoxybutanoyl)-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 167617428) has the molecular formula C32H36N4O9 and a molecular weight of 620.66 g/mol. Its IUPAC name is [2-[4-(2-azidoethoxy)butanoyl]-7-(4-propoxybutanoyl)-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | [2-[4-(2-azidoethoxy)butanoyl]-7-(4-propoxybutanoyl)-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 167617428 |
| Molecular Formula | C32H36N4O9 |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | [2-[4-(2-azidoethoxy)butanoyl]-7-(4-propoxybutanoyl)-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | CCCOCCCC(=O)c1ccc2c(c1)C(COC(=O)ON1C(=O)CCC1=O)c1cc(C(=O)CCCOCCN=[N+]=[N-])ccc1-2 |
| InChI | InChI=1S/C32H36N4O9/c1-2-14-42-15-3-5-28(37)21-7-9-23-24-10-8-22(29(38)6-4-16-43-17-13-34-35-33)19-26(24)27(25(23)18-21)20-44-32(41)45-36-30(39)11-12-31(36)40/h7-10,18-19,27H,2-6,11-17,20H2,1H3 |
| InChIKey | LYDPLOSDUNEXDP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 174.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|