C34H47N3O8 — CID 158539529
[2-[[5-(2-butoxyethylamino)-5-oxopentanoyl]amino]-5-[4-(4-hydroxybutoxy)butanoyl]-9H-fluoren-9-yl]methyl N-deuteriocarbamate (PubChem CID 158539529) has the molecular formula C34H47N3O8 and a molecular weight of 626.77 g/mol. Its IUPAC name is [2-[[5-(2-butoxyethylamino)-5-oxopentanoyl]amino]-5-[4-(4-hydroxybutoxy)butanoyl]-9H-fluoren-9-yl]methyl N-deuteriocarbamate.
| Compound Name | [2-[[5-(2-butoxyethylamino)-5-oxopentanoyl]amino]-5-[4-(4-hydroxybutoxy)butanoyl]-9H-fluoren-9-yl]methyl N-deuteriocarbamate |
|---|---|
| PubChem CID | 158539529 |
| Molecular Formula | C34H47N3O8 |
| Molecular Weight | 626.77 g/mol |
| Exact Mass | 626.34 |
| IUPAC Name | [2-[[5-(2-butoxyethylamino)-5-oxopentanoyl]amino]-5-[4-(4-hydroxybutoxy)butanoyl]-9H-fluoren-9-yl]methyl N-deuteriocarbamate |
| SMILES | [2H]NC(=O)OCC1c2cc(NC(=O)CCCC(=O)NCCOCCCC)ccc2-c2c(C(=O)CCCOCCCCO)cccc21 |
| InChI | InChI=1S/C34H47N3O8/c1-2-3-18-44-21-16-36-31(40)12-7-13-32(41)37-24-14-15-26-28(22-24)29(23-45-34(35)42)25-9-6-10-27(33(25)26)30(39)11-8-20-43-19-5-4-17-38/h6,9-10,14-15,22,29,38H,2-5,7-8,11-13,16-21,23H2,1H3,(H2,35,42)(H,36,40)(H,37,41)/i/hD |
| InChIKey | WPPHKLCTPXHAEN-DYCDLGHISA-N |
| XLogP | 4.69 |
| TPSA | 166.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.77 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|