C27H35BIN2O6P — CID 159351651
[5-(4-methoxybutanoyl)-2-[4-(2-methoxyethylamino)-4-oxobutyl]-9H-fluoren-9-yl]methyl N-[iodo(phosphanyl)boranyl]carbamate (PubChem CID 159351651) has the molecular formula C27H35BIN2O6P and a molecular weight of 652.27 g/mol. Its IUPAC name is [5-(4-methoxybutanoyl)-2-[4-(2-methoxyethylamino)-4-oxobutyl]-9H-fluoren-9-yl]methyl N-[iodo(phosphanyl)boranyl]carbamate.
| Compound Name | [5-(4-methoxybutanoyl)-2-[4-(2-methoxyethylamino)-4-oxobutyl]-9H-fluoren-9-yl]methyl N-[iodo(phosphanyl)boranyl]carbamate |
|---|---|
| PubChem CID | 159351651 |
| Molecular Formula | C27H35BIN2O6P |
| Molecular Weight | 652.27 g/mol |
| Exact Mass | 652.14 |
| IUPAC Name | [5-(4-methoxybutanoyl)-2-[4-(2-methoxyethylamino)-4-oxobutyl]-9H-fluoren-9-yl]methyl N-[iodo(phosphanyl)boranyl]carbamate |
| SMILES | COCCCC(=O)c1cccc2c1-c1ccc(CCCC(=O)NCCOC)cc1C2COC(=O)NB(P)I |
| InChI | InChI=1S/C27H35BIN2O6P/c1-35-14-5-9-24(32)21-8-4-7-19-23(17-37-27(34)31-28(29)38)22-16-18(11-12-20(22)26(19)21)6-3-10-25(33)30-13-15-36-2/h4,7-8,11-12,16,23H,3,5-6,9-10,13-15,17,38H2,1-2H3,(H,30,33)(H,31,34) |
| InChIKey | LHKAYWKMXYRKQP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|