C35H45N3O7 — CID 165040419
[2-[4-(2-but-1-en-2-yloxyethylamino)-4-oxobutyl]-7-[4-oxo-4-[2-(4-oxobut-1-en-2-yloxy)ethylamino]butyl]-9H-fluoren-9-yl]methyl N-deuteriocarbamate (PubChem CID 165040419) has the molecular formula C35H45N3O7 and a molecular weight of 620.77 g/mol. Its IUPAC name is [2-[4-(2-but-1-en-2-yloxyethylamino)-4-oxobutyl]-7-[4-oxo-4-[2-(4-oxobut-1-en-2-yloxy)ethylamino]butyl]-9H-fluoren-9-yl]methyl N-deuteriocarbamate.
| Compound Name | [2-[4-(2-but-1-en-2-yloxyethylamino)-4-oxobutyl]-7-[4-oxo-4-[2-(4-oxobut-1-en-2-yloxy)ethylamino]butyl]-9H-fluoren-9-yl]methyl N-deuteriocarbamate |
|---|---|
| PubChem CID | 165040419 |
| Molecular Formula | C35H45N3O7 |
| Molecular Weight | 620.77 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | [2-[4-(2-but-1-en-2-yloxyethylamino)-4-oxobutyl]-7-[4-oxo-4-[2-(4-oxobut-1-en-2-yloxy)ethylamino]butyl]-9H-fluoren-9-yl]methyl N-deuteriocarbamate |
| SMILES | [2H]NC(=O)OCC1c2cc(CCCC(=O)NCCOC(=C)CC)ccc2-c2ccc(CCCC(=O)NCCOC(=C)CC=O)cc21 |
| InChI | InChI=1S/C35H45N3O7/c1-4-24(2)43-19-16-37-33(40)9-5-7-26-11-13-28-29-14-12-27(22-31(29)32(30(28)21-26)23-45-35(36)42)8-6-10-34(41)38-17-20-44-25(3)15-18-39/h11-14,18,21-22,32H,2-10,15-17,19-20,23H2,1H3,(H2,36,42)(H,37,40)(H,38,41)/i/hD |
| InChIKey | POCWLVZFBYKGQK-DYCDLGHISA-N |
| XLogP | 4.83 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.77 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|