C37H50N4O5 — CID 157409610
ethane;[2-[4-oxo-4-(propylamino)butyl]-5-pentanoyl-9H-fluoren-9-yl]methyl (3R)-3-(1H-imidazol-5-ylmethyl)-4-(methylamino)-4-oxobutanoate (PubChem CID 157409610) has the molecular formula C37H50N4O5 and a molecular weight of 630.83 g/mol. Its IUPAC name is ethane;[2-[4-oxo-4-(propylamino)butyl]-5-pentanoyl-9H-fluoren-9-yl]methyl (3R)-3-(1H-imidazol-5-ylmethyl)-4-(methylamino)-4-oxobutanoate.
| Compound Name | ethane;[2-[4-oxo-4-(propylamino)butyl]-5-pentanoyl-9H-fluoren-9-yl]methyl (3R)-3-(1H-imidazol-5-ylmethyl)-4-(methylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 157409610 |
| Molecular Formula | C37H50N4O5 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.38 |
| IUPAC Name | ethane;[2-[4-oxo-4-(propylamino)butyl]-5-pentanoyl-9H-fluoren-9-yl]methyl (3R)-3-(1H-imidazol-5-ylmethyl)-4-(methylamino)-4-oxobutanoate |
| SMILES | CC.CCCCC(=O)c1cccc2c1-c1ccc(CCCC(=O)NCCC)cc1C2COC(=O)C[C@@H](Cc1cnc[nH]1)C(=O)NC |
| InChI | InChI=1S/C35H44N4O5.C2H6/c1-4-6-12-31(40)28-11-8-10-26-30(21-44-33(42)19-24(35(43)36-3)18-25-20-37-22-39-25)29-17-23(14-15-27(29)34(26)28)9-7-13-32(41)38-16-5-2;1-2/h8,10-11,14-15,17,20,22,24,30H,4-7,9,12-13,16,18-19,21H2,1-3H3,(H,36,43)(H,37,39)(H,38,41);1-2H3/t24-,30?;/m1./s1 |
| InChIKey | BOCUNWXKTJRNLG-VCXYMRJQSA-N |
| XLogP | 6.31 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |