C19H26Br2N6O6 — CID 155445623
N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3,4-bis[(2-bromoacetyl)amino]benzamide (PubChem CID 155445623) has the molecular formula C19H26Br2N6O6 and a molecular weight of 594.26 g/mol. Its IUPAC name is N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3,4-bis[(2-bromoacetyl)amino]benzamide.
| Compound Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3,4-bis[(2-bromoacetyl)amino]benzamide |
|---|---|
| PubChem CID | 155445623 |
| Molecular Formula | C19H26Br2N6O6 |
| Molecular Weight | 594.26 g/mol |
| Exact Mass | 592.03 |
| IUPAC Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3,4-bis[(2-bromoacetyl)amino]benzamide |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNC(=O)c1ccc(NC(=O)CBr)c(NC(=O)CBr)c1 |
| InChI | InChI=1S/C19H26Br2N6O6/c20-12-17(28)25-15-2-1-14(11-16(15)26-18(29)13-21)19(30)23-3-5-31-7-9-33-10-8-32-6-4-24-27-22/h1-2,11H,3-10,12-13H2,(H,23,30)(H,25,28)(H,26,29) |
| InChIKey | NTAGKGQNUQTKQL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 163.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|