C14H20N4O5 — CID 155649739
2-[2-(2-azidoethoxy)ethoxy]-N-[2-(3,4-dihydroxyphenyl)ethyl]acetamide (PubChem CID 155649739) has the molecular formula C14H20N4O5 and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-[2-(2-azidoethoxy)ethoxy]-N-[2-(3,4-dihydroxyphenyl)ethyl]acetamide.
| Compound Name | 2-[2-(2-azidoethoxy)ethoxy]-N-[2-(3,4-dihydroxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 155649739 |
| Molecular Formula | C14H20N4O5 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-[2-(2-azidoethoxy)ethoxy]-N-[2-(3,4-dihydroxyphenyl)ethyl]acetamide |
| SMILES | [N-]=[N+]=NCCOCCOCC(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H20N4O5/c15-18-17-5-6-22-7-8-23-10-14(21)16-4-3-11-1-2-12(19)13(20)9-11/h1-2,9,19-20H,3-8,10H2,(H,16,21) |
| InChIKey | CVNDGZYICXSNCK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 136.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|