C27H23N3O5S — CID 145051648
5-(7-azido-3-sulfanylideneheptyl)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 145051648) has the molecular formula C27H23N3O5S and a molecular weight of 501.56 g/mol. Its IUPAC name is 5-(7-azido-3-sulfanylideneheptyl)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-(7-azido-3-sulfanylideneheptyl)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 145051648 |
| Molecular Formula | C27H23N3O5S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 5-(7-azido-3-sulfanylideneheptyl)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | [N-]=[N+]=NCCCCC(=S)CCc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C27H23N3O5S/c28-30-29-12-2-1-3-19(36)8-4-16-5-9-20(23(13-16)27(33)34)26-21-10-6-17(31)14-24(21)35-25-15-18(32)7-11-22(25)26/h5-7,9-11,13-15,31H,1-4,8,12H2,(H,33,34) |
| InChIKey | QSCGECDEECFEHJ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 136.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|