C30H38N4O10 — CID 170116384
N-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-(7,8-dimethoxy-4-oxochromen-2-yl)benzamide (PubChem CID 170116384) has the molecular formula C30H38N4O10 and a molecular weight of 614.65 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-(7,8-dimethoxy-4-oxochromen-2-yl)benzamide.
| Compound Name | N-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-(7,8-dimethoxy-4-oxochromen-2-yl)benzamide |
|---|---|
| PubChem CID | 170116384 |
| Molecular Formula | C30H38N4O10 |
| Molecular Weight | 614.65 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | N-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-(7,8-dimethoxy-4-oxochromen-2-yl)benzamide |
| SMILES | COc1ccc2c(=O)cc(-c3ccc(C(=O)NCCOCCOCCOCCOCCOCCN=[N+]=[N-])cc3)oc2c1OC |
| InChI | InChI=1S/C30H38N4O10/c1-37-26-8-7-24-25(35)21-27(44-28(24)29(26)38-2)22-3-5-23(6-4-22)30(36)32-9-11-39-13-15-41-17-19-43-20-18-42-16-14-40-12-10-33-34-31/h3-8,21H,9-20H2,1-2H3,(H,32,36) |
| InChIKey | UGKSKKXXXCVWCA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 172.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.65 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|