C26H19F2N7O6 — CID 163860074
5-[2-[(4,6-diamino-1,3,5-triazin-2-yl)amino]ethylcarbamoyl]-2-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 163860074) has the molecular formula C26H19F2N7O6 and a molecular weight of 563.48 g/mol. Its IUPAC name is 5-[2-[(4,6-diamino-1,3,5-triazin-2-yl)amino]ethylcarbamoyl]-2-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[2-[(4,6-diamino-1,3,5-triazin-2-yl)amino]ethylcarbamoyl]-2-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 163860074 |
| Molecular Formula | C26H19F2N7O6 |
| Molecular Weight | 563.48 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 5-[2-[(4,6-diamino-1,3,5-triazin-2-yl)amino]ethylcarbamoyl]-2-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | Nc1nc(N)nc(NCCNC(=O)c2ccc(-c3c4cc(F)c(=O)cc-4oc4cc(O)c(F)cc34)c(C(=O)O)c2)n1 |
| InChI | InChI=1S/C26H19F2N7O6/c27-15-6-13-19(8-17(15)36)41-20-9-18(37)16(28)7-14(20)21(13)11-2-1-10(5-12(11)23(39)40)22(38)31-3-4-32-26-34-24(29)33-25(30)35-26/h1-2,5-9,36H,3-4H2,(H,31,38)(H,39,40)(H5,29,30,32,33,34,35) |
| InChIKey | NVMOFGVIJUDYPN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 219.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|