C30H24O9 — CID 10186645
2-(2,7-diethyl-3-hydroxy-6-oxoxanthen-9-yl)-5-(2,5-dioxocyclopentyl)oxycarbonylbenzoic acid (PubChem CID 10186645) has the molecular formula C30H24O9 and a molecular weight of 528.51 g/mol. Its IUPAC name is 2-(2,7-diethyl-3-hydroxy-6-oxoxanthen-9-yl)-5-(2,5-dioxocyclopentyl)oxycarbonylbenzoic acid.
| Compound Name | 2-(2,7-diethyl-3-hydroxy-6-oxoxanthen-9-yl)-5-(2,5-dioxocyclopentyl)oxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 10186645 |
| Molecular Formula | C30H24O9 |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 2-(2,7-diethyl-3-hydroxy-6-oxoxanthen-9-yl)-5-(2,5-dioxocyclopentyl)oxycarbonylbenzoic acid |
| SMILES | CCc1cc2c(-c3ccc(C(=O)OC4C(=O)CCC4=O)cc3C(=O)O)c3cc(CC)c(=O)cc-3oc2cc1O |
| InChI | InChI=1S/C30H24O9/c1-3-14-9-19-25(12-23(14)33)38-26-13-24(34)15(4-2)10-20(26)27(19)17-6-5-16(11-18(17)29(35)36)30(37)39-28-21(31)7-8-22(28)32/h5-6,9-13,28,33H,3-4,7-8H2,1-2H3,(H,35,36) |
| InChIKey | QMANNNNDCWDNTQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|