C26H22INO6 — CID 101448510
2-(2,7-diethyl-3-hydroxy-6-oxoxanthen-9-yl)-5-[(2-iodoacetyl)amino]benzoic acid (PubChem CID 101448510) has the molecular formula C26H22INO6 and a molecular weight of 571.37 g/mol. Its IUPAC name is 2-(2,7-diethyl-3-hydroxy-6-oxoxanthen-9-yl)-5-[(2-iodoacetyl)amino]benzoic acid.
| Compound Name | 2-(2,7-diethyl-3-hydroxy-6-oxoxanthen-9-yl)-5-[(2-iodoacetyl)amino]benzoic acid |
|---|---|
| PubChem CID | 101448510 |
| Molecular Formula | C26H22INO6 |
| Molecular Weight | 571.37 g/mol |
| Exact Mass | 571.05 |
| IUPAC Name | 2-(2,7-diethyl-3-hydroxy-6-oxoxanthen-9-yl)-5-[(2-iodoacetyl)amino]benzoic acid |
| SMILES | CCc1cc2c(-c3ccc(NC(=O)CI)cc3C(=O)O)c3cc(CC)c(=O)cc-3oc2cc1O |
| InChI | InChI=1S/C26H22INO6/c1-3-13-7-18-22(10-20(13)29)34-23-11-21(30)14(4-2)8-19(23)25(18)16-6-5-15(28-24(31)12-27)9-17(16)26(32)33/h5-11,29H,3-4,12H2,1-2H3,(H,28,31)(H,32,33) |
| InChIKey | ZYBSYYSTNRJNKS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.37 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|