C24H15F2NO6 — CID 143639076
5-carbamoyl-2-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid;prop-1-yne (PubChem CID 143639076) has the molecular formula C24H15F2NO6 and a molecular weight of 451.38 g/mol. Its IUPAC name is 5-carbamoyl-2-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid;prop-1-yne.
| Compound Name | 5-carbamoyl-2-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid;prop-1-yne |
|---|---|
| PubChem CID | 143639076 |
| Molecular Formula | C24H15F2NO6 |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 5-carbamoyl-2-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid;prop-1-yne |
| SMILES | C#CC.NC(=O)c1ccc(-c2c3cc(F)c(=O)cc-3oc3cc(O)c(F)cc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C21H11F2NO6.C3H4/c22-13-4-11-17(6-15(13)25)30-18-7-16(26)14(23)5-12(18)19(11)9-2-1-8(20(24)27)3-10(9)21(28)29;1-3-2/h1-7,25H,(H2,24,27)(H,28,29);1H,2H3 |
| InChIKey | VEIZPIBCLSKOPO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|