C21H13F2N2O5- — CID 102140076
9-[3-amino-2-carboxy-4-(methylamino)phenyl]-2,7-difluoro-6-oxoxanthen-3-olate (PubChem CID 102140076) has the molecular formula C21H13F2N2O5- and a molecular weight of 411.34 g/mol. Its IUPAC name is 9-[3-amino-2-carboxy-4-(methylamino)phenyl]-2,7-difluoro-6-oxoxanthen-3-olate.
| Compound Name | 9-[3-amino-2-carboxy-4-(methylamino)phenyl]-2,7-difluoro-6-oxoxanthen-3-olate |
|---|---|
| PubChem CID | 102140076 |
| Molecular Formula | C21H13F2N2O5- |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 9-[3-amino-2-carboxy-4-(methylamino)phenyl]-2,7-difluoro-6-oxoxanthen-3-olate |
| SMILES | CNc1ccc(-c2c3cc(F)c(=O)cc-3oc3cc([O-])c(F)cc23)c(C(=O)O)c1N |
| InChI | InChI=1S/C21H14F2N2O5/c1-25-13-3-2-8(19(20(13)24)21(28)29)18-9-4-11(22)14(26)6-16(9)30-17-7-15(27)12(23)5-10(17)18/h2-7,25-26H,24H2,1H3,(H,28,29)/p-1 |
| InChIKey | BJTLSPOVXMBXRZ-UHFFFAOYSA-M |
| XLogP | 3.24 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|