C19H11O6- — CID 137316141
2,7-dihydroxy-9-(4-hydroxyphenyl)-6-oxoxanthen-3-olate (PubChem CID 137316141) has the molecular formula C19H11O6- and a molecular weight of 335.29 g/mol. Its IUPAC name is 2,7-dihydroxy-9-(4-hydroxyphenyl)-6-oxoxanthen-3-olate.
| Compound Name | 2,7-dihydroxy-9-(4-hydroxyphenyl)-6-oxoxanthen-3-olate |
|---|---|
| PubChem CID | 137316141 |
| Molecular Formula | C19H11O6- |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2,7-dihydroxy-9-(4-hydroxyphenyl)-6-oxoxanthen-3-olate |
| SMILES | O=c1cc2oc3cc([O-])c(O)cc3c(-c3ccc(O)cc3)c-2cc1O |
| InChI | InChI=1S/C19H12O6/c20-10-3-1-9(2-4-10)19-11-5-13(21)15(23)7-17(11)25-18-8-16(24)14(22)6-12(18)19/h1-8,20-23H/p-1 |
| InChIKey | BNBOKEDNAXBOBC-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|