C26H19NO7S — CID 71673882
4-methyl-N-[2-(2,3,7-trihydroxy-6-oxoxanthen-9-yl)phenyl]benzenesulfonamide (PubChem CID 71673882) has the molecular formula C26H19NO7S and a molecular weight of 489.51 g/mol. Its IUPAC name is 4-methyl-N-[2-(2,3,7-trihydroxy-6-oxoxanthen-9-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-(2,3,7-trihydroxy-6-oxoxanthen-9-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71673882 |
| Molecular Formula | C26H19NO7S |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 4-methyl-N-[2-(2,3,7-trihydroxy-6-oxoxanthen-9-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2-c2c3cc(O)c(=O)cc-3oc3cc(O)c(O)cc23)cc1 |
| InChI | InChI=1S/C26H19NO7S/c1-14-6-8-15(9-7-14)35(32,33)27-19-5-3-2-4-16(19)26-17-10-20(28)22(30)12-24(17)34-25-13-23(31)21(29)11-18(25)26/h2-13,27-30H,1H3 |
| InChIKey | YYNGLDAZUWSQAB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|