C23H20O7 — CID 21215142
9-(3,4-diethoxyphenyl)-2,6,7-trihydroxyxanthen-3-one (PubChem CID 21215142) has the molecular formula C23H20O7 and a molecular weight of 408.41 g/mol. Its IUPAC name is 9-(3,4-diethoxyphenyl)-2,6,7-trihydroxyxanthen-3-one.
| Compound Name | 9-(3,4-diethoxyphenyl)-2,6,7-trihydroxyxanthen-3-one |
|---|---|
| PubChem CID | 21215142 |
| Molecular Formula | C23H20O7 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 9-(3,4-diethoxyphenyl)-2,6,7-trihydroxyxanthen-3-one |
| SMILES | CCOc1ccc(-c2c3cc(O)c(=O)cc-3oc3cc(O)c(O)cc23)cc1OCC |
| InChI | InChI=1S/C23H20O7/c1-3-28-19-6-5-12(7-22(19)29-4-2)23-13-8-15(24)17(26)10-20(13)30-21-11-18(27)16(25)9-14(21)23/h5-11,24-26H,3-4H2,1-2H3 |
| InChIKey | WUAMEJZHMKCFBR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|