C23H18O7 — CID 2931720
2,6,7-trihydroxy-9-(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)xanthen-3-one (PubChem CID 2931720) has the molecular formula C23H18O7 and a molecular weight of 406.39 g/mol. Its IUPAC name is 2,6,7-trihydroxy-9-(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)xanthen-3-one.
| Compound Name | 2,6,7-trihydroxy-9-(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)xanthen-3-one |
|---|---|
| PubChem CID | 2931720 |
| Molecular Formula | C23H18O7 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2,6,7-trihydroxy-9-(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)xanthen-3-one |
| SMILES | C=CCc1cc(-c2c3cc(O)c(=O)cc-3oc3cc(O)c(O)cc23)cc(OC)c1O |
| InChI | InChI=1S/C23H18O7/c1-3-4-11-5-12(6-21(29-2)23(11)28)22-13-7-15(24)17(26)9-19(13)30-20-10-18(27)16(25)8-14(20)22/h3,5-10,24-26,28H,1,4H2,2H3 |
| InChIKey | UAWKMTJIAIDPSI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|