C22H18F2N2O2 — CID 155930043
6-(2-aminoethylamino)-2,7-difluoro-9-(2-methylphenyl)xanthen-3-one (PubChem CID 155930043) has the molecular formula C22H18F2N2O2 and a molecular weight of 380.39 g/mol. Its IUPAC name is 6-(2-aminoethylamino)-2,7-difluoro-9-(2-methylphenyl)xanthen-3-one.
| Compound Name | 6-(2-aminoethylamino)-2,7-difluoro-9-(2-methylphenyl)xanthen-3-one |
|---|---|
| PubChem CID | 155930043 |
| Molecular Formula | C22H18F2N2O2 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 6-(2-aminoethylamino)-2,7-difluoro-9-(2-methylphenyl)xanthen-3-one |
| SMILES | Cc1ccccc1-c1c2cc(F)c(=O)cc-2oc2cc(NCCN)c(F)cc12 |
| InChI | InChI=1S/C22H18F2N2O2/c1-12-4-2-3-5-13(12)22-14-8-16(23)18(26-7-6-25)10-20(14)28-21-11-19(27)17(24)9-15(21)22/h2-5,8-11,26H,6-7,25H2,1H3 |
| InChIKey | ZNEHHYUAHLVYCF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|