C26H29N2O+ — CID 144765228
diethyl-[6-(ethylamino)-9-(2-methylphenyl)xanthen-3-ylidene]azanium (PubChem CID 144765228) has the molecular formula C26H29N2O+ and a molecular weight of 385.53 g/mol. Its IUPAC name is diethyl-[6-(ethylamino)-9-(2-methylphenyl)xanthen-3-ylidene]azanium.
| Compound Name | diethyl-[6-(ethylamino)-9-(2-methylphenyl)xanthen-3-ylidene]azanium |
|---|---|
| PubChem CID | 144765228 |
| Molecular Formula | C26H29N2O+ |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | diethyl-[6-(ethylamino)-9-(2-methylphenyl)xanthen-3-ylidene]azanium |
| SMILES | CCNc1ccc2c(-c3ccccc3C)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C26H28N2O/c1-5-27-19-12-14-22-24(16-19)29-25-17-20(28(6-2)7-3)13-15-23(25)26(22)21-11-9-8-10-18(21)4/h8-17H,5-7H2,1-4H3/p+1 |
| InChIKey | ASVSCTOUXDWSDZ-UHFFFAOYSA-O |
| XLogP | 5.76 |
| TPSA | 28.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|