C34H36NO4S+ — CID 58445122
[6-[(2,6-dimethylphenyl)methyl]-9-(2-sulfophenyl)xanthen-3-ylidene]-dipropylazanium (PubChem CID 58445122) has the molecular formula C34H36NO4S+ and a molecular weight of 554.73 g/mol. Its IUPAC name is [6-[(2,6-dimethylphenyl)methyl]-9-(2-sulfophenyl)xanthen-3-ylidene]-dipropylazanium.
| Compound Name | [6-[(2,6-dimethylphenyl)methyl]-9-(2-sulfophenyl)xanthen-3-ylidene]-dipropylazanium |
|---|---|
| PubChem CID | 58445122 |
| Molecular Formula | C34H36NO4S+ |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | [6-[(2,6-dimethylphenyl)methyl]-9-(2-sulfophenyl)xanthen-3-ylidene]-dipropylazanium |
| SMILES | CCC[N+](CCC)=c1ccc2c(-c3ccccc3S(=O)(=O)O)c3ccc(Cc4c(C)cccc4C)cc3oc-2c1 |
| InChI | InChI=1S/C34H35NO4S/c1-5-18-35(19-6-2)26-15-17-28-32(22-26)39-31-21-25(20-30-23(3)10-9-11-24(30)4)14-16-27(31)34(28)29-12-7-8-13-33(29)40(36,37)38/h7-17,21-22H,5-6,18-20H2,1-4H3/p+1 |
| InChIKey | ZGXBFHIURZIGLE-UHFFFAOYSA-O |
| XLogP | 7.25 |
| TPSA | 70.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|