C33H27N2O4S+ — CID 21340331
methyl-[6-(N-methylanilino)-9-(2-sulfophenyl)xanthen-3-ylidene]-phenylazanium (PubChem CID 21340331) has the molecular formula C33H27N2O4S+ and a molecular weight of 547.66 g/mol. Its IUPAC name is methyl-[6-(N-methylanilino)-9-(2-sulfophenyl)xanthen-3-ylidene]-phenylazanium.
| Compound Name | methyl-[6-(N-methylanilino)-9-(2-sulfophenyl)xanthen-3-ylidene]-phenylazanium |
|---|---|
| PubChem CID | 21340331 |
| Molecular Formula | C33H27N2O4S+ |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | methyl-[6-(N-methylanilino)-9-(2-sulfophenyl)xanthen-3-ylidene]-phenylazanium |
| SMILES | CN(c1ccccc1)c1ccc2c(-c3ccccc3S(=O)(=O)O)c3cc/c(=[N+](/C)c4ccccc4)cc-3oc2c1 |
| InChI | InChI=1S/C33H26N2O4S/c1-34(23-11-5-3-6-12-23)25-17-19-27-30(21-25)39-31-22-26(35(2)24-13-7-4-8-14-24)18-20-28(31)33(27)29-15-9-10-16-32(29)40(36,37)38/h3-22H,1-2H3/p+1 |
| InChIKey | NMUVBRCKIFZHGI-UHFFFAOYSA-O |
| XLogP | 6.95 |
| TPSA | 73.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|