C44H48N5O3S+ — CID 163940401
methyl-[6-(N-methylanilino)-9-[3-[4-(N'-pentylcarbamimidoyl)piperidin-1-yl]sulfonylphenyl]xanthen-3-ylidene]-phenylazanium (PubChem CID 163940401) has the molecular formula C44H48N5O3S+ and a molecular weight of 726.97 g/mol. Its IUPAC name is methyl-[6-(N-methylanilino)-9-[3-[4-(N'-pentylcarbamimidoyl)piperidin-1-yl]sulfonylphenyl]xanthen-3-ylidene]-phenylazanium.
| Compound Name | methyl-[6-(N-methylanilino)-9-[3-[4-(N'-pentylcarbamimidoyl)piperidin-1-yl]sulfonylphenyl]xanthen-3-ylidene]-phenylazanium |
|---|---|
| PubChem CID | 163940401 |
| Molecular Formula | C44H48N5O3S+ |
| Molecular Weight | 726.97 g/mol |
| Exact Mass | 726.35 |
| IUPAC Name | methyl-[6-(N-methylanilino)-9-[3-[4-(N'-pentylcarbamimidoyl)piperidin-1-yl]sulfonylphenyl]xanthen-3-ylidene]-phenylazanium |
| SMILES | CCCCC/N=C(\N)C1CCN(S(=O)(=O)c2cccc(-c3c4cc/c(=[N+](\C)c5ccccc5)cc-4oc4cc(N(C)c5ccccc5)ccc34)c2)CC1 |
| InChI | InChI=1S/C44H48N5O3S/c1-4-5-12-26-46-44(45)32-24-27-49(28-25-32)53(50,51)38-19-13-14-33(29-38)43-39-22-20-36(47(2)34-15-8-6-9-16-34)30-41(39)52-42-31-37(21-23-40(42)43)48(3)35-17-10-7-11-18-35/h6-11,13-23,29-32H,4-5,12,24-28H2,1-3H3,(H2,45,46)/q+1 |
| InChIKey | RQMPBJBZSLGSSE-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.97 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|