C33H40N3O8S2+ — CID 58729549
[9-[4-(2-carboxypiperidin-1-yl)sulfonyl-2-(trioxidanylsulfanyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 58729549) has the molecular formula C33H40N3O8S2+ and a molecular weight of 670.83 g/mol. Its IUPAC name is [9-[4-(2-carboxypiperidin-1-yl)sulfonyl-2-(trioxidanylsulfanyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-[4-(2-carboxypiperidin-1-yl)sulfonyl-2-(trioxidanylsulfanyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 58729549 |
| Molecular Formula | C33H40N3O8S2+ |
| Molecular Weight | 670.83 g/mol |
| Exact Mass | 670.23 |
| IUPAC Name | [9-[4-(2-carboxypiperidin-1-yl)sulfonyl-2-(trioxidanylsulfanyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)N4CCCCC4C(=O)O)cc3SOOO)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C33H39N3O8S2/c1-5-34(6-2)22-12-15-25-29(19-22)42-30-20-23(35(7-3)8-4)13-16-26(30)32(25)27-17-14-24(21-31(27)45-44-43-39)46(40,41)36-18-10-9-11-28(36)33(37)38/h12-17,19-21,28H,5-11,18H2,1-4H3,(H-,37,38,39)/p+1 |
| InChIKey | XUCBJEFQZCYEEF-UHFFFAOYSA-O |
| XLogP | 5.92 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.83 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|