C41H44N3O3S3+ — CID 157278559
[9-[2-[diethyl(nitrosooxy)-λ4-sulfanyl]phenyl]-6-[ethyl(phenylsulfanylmethyl)amino]xanthen-3-ylidene]-ethyl-(phenylsulfanylmethyl)azanium (PubChem CID 157278559) has the molecular formula C41H44N3O3S3+ and a molecular weight of 723.02 g/mol. Its IUPAC name is [9-[2-[diethyl(nitrosooxy)-λ4-sulfanyl]phenyl]-6-[ethyl(phenylsulfanylmethyl)amino]xanthen-3-ylidene]-ethyl-(phenylsulfanylmethyl)azanium.
| Compound Name | [9-[2-[diethyl(nitrosooxy)-λ4-sulfanyl]phenyl]-6-[ethyl(phenylsulfanylmethyl)amino]xanthen-3-ylidene]-ethyl-(phenylsulfanylmethyl)azanium |
|---|---|
| PubChem CID | 157278559 |
| Molecular Formula | C41H44N3O3S3+ |
| Molecular Weight | 723.02 g/mol |
| Exact Mass | 722.25 |
| IUPAC Name | [9-[2-[diethyl(nitrosooxy)-λ4-sulfanyl]phenyl]-6-[ethyl(phenylsulfanylmethyl)amino]xanthen-3-ylidene]-ethyl-(phenylsulfanylmethyl)azanium |
| SMILES | CCN(CSc1ccccc1)c1ccc2c(-c3ccccc3S(CC)(CC)ON=O)c3ccc(=[N+](CC)CSc4ccccc4)cc-3oc2c1 |
| InChI | InChI=1S/C41H44N3O3S3/c1-5-43(29-48-33-17-11-9-12-18-33)31-23-25-35-38(27-31)46-39-28-32(44(6-2)30-49-34-19-13-10-14-20-34)24-26-36(39)41(35)37-21-15-16-22-40(37)50(7-3,8-4)47-42-45/h9-28H,5-8,29-30H2,1-4H3/q+1 |
| InChIKey | JBSMQCWKXMVWDA-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 58.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.02 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|