C28H33N2O6S2+ — CID 58729586
[6-(diethylamino)-9-[4-methylsulfonyl-2-(trioxidanylsulfanyl)phenyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 58729586) has the molecular formula C28H33N2O6S2+ and a molecular weight of 557.71 g/mol. Its IUPAC name is [6-(diethylamino)-9-[4-methylsulfonyl-2-(trioxidanylsulfanyl)phenyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[4-methylsulfonyl-2-(trioxidanylsulfanyl)phenyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 58729586 |
| Molecular Formula | C28H33N2O6S2+ |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | [6-(diethylamino)-9-[4-methylsulfonyl-2-(trioxidanylsulfanyl)phenyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(C)(=O)=O)cc3SOOO)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C28H32N2O6S2/c1-6-29(7-2)19-10-13-22-25(16-19)34-26-17-20(30(8-3)9-4)11-14-23(26)28(22)24-15-12-21(38(5,32)33)18-27(24)37-36-35-31/h10-18H,6-9H2,1-5H3/p+1 |
| InChIKey | NSXNYSOQPVNEMG-UHFFFAOYSA-O |
| XLogP | 5.69 |
| TPSA | 92.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|