C33H39N3O8S2 — CID 58729548
[9-[4-(2-carboxypiperidin-1-yl)sulfonyl-2-oxidoperoxysulfanylphenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 58729548) has the molecular formula C33H39N3O8S2 and a molecular weight of 669.82 g/mol. Its IUPAC name is [9-[4-(2-carboxypiperidin-1-yl)sulfonyl-2-oxidoperoxysulfanylphenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-[4-(2-carboxypiperidin-1-yl)sulfonyl-2-oxidoperoxysulfanylphenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 58729548 |
| Molecular Formula | C33H39N3O8S2 |
| Molecular Weight | 669.82 g/mol |
| Exact Mass | 669.22 |
| IUPAC Name | [9-[4-(2-carboxypiperidin-1-yl)sulfonyl-2-oxidoperoxysulfanylphenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)N4CCCCC4C(=O)O)cc3SOO[O-])c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C33H39N3O8S2/c1-5-34(6-2)22-12-15-25-29(19-22)42-30-20-23(35(7-3)8-4)13-16-26(30)32(25)27-17-14-24(21-31(27)45-44-43-39)46(40,41)36-18-10-9-11-28(36)33(37)38/h12-17,19-21,28H,5-11,18H2,1-4H3,(H-,37,38,39) |
| InChIKey | XUCBJEFQZCYEEF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.82 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|