C31H38Cl2N3O6S2+ — CID 58729523
[9-[4-[bis(2-chloroethyl)sulfamoyl]-2-(trioxidanylsulfanyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 58729523) has the molecular formula C31H38Cl2N3O6S2+ and a molecular weight of 683.70 g/mol. Its IUPAC name is [9-[4-[bis(2-chloroethyl)sulfamoyl]-2-(trioxidanylsulfanyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-[4-[bis(2-chloroethyl)sulfamoyl]-2-(trioxidanylsulfanyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 58729523 |
| Molecular Formula | C31H38Cl2N3O6S2+ |
| Molecular Weight | 683.70 g/mol |
| Exact Mass | 682.16 |
| IUPAC Name | [9-[4-[bis(2-chloroethyl)sulfamoyl]-2-(trioxidanylsulfanyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)N(CCCl)CCCl)cc3SOOO)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C31H37Cl2N3O6S2/c1-5-34(6-2)22-9-12-25-28(19-22)40-29-20-23(35(7-3)8-4)10-13-26(29)31(25)27-14-11-24(21-30(27)43-42-41-37)44(38,39)36(17-15-32)18-16-33/h9-14,19-21H,5-8,15-18H2,1-4H3/p+1 |
| InChIKey | QUDGMFQKYPVUKL-UHFFFAOYSA-O |
| XLogP | 6.76 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.70 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|