C30H37N4O8S2+ — CID 58729537
[9-[4-[2-(carboxyamino)ethylsulfamoyl]-2-(trioxidanylsulfanyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 58729537) has the molecular formula C30H37N4O8S2+ and a molecular weight of 645.78 g/mol. Its IUPAC name is [9-[4-[2-(carboxyamino)ethylsulfamoyl]-2-(trioxidanylsulfanyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-[4-[2-(carboxyamino)ethylsulfamoyl]-2-(trioxidanylsulfanyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 58729537 |
| Molecular Formula | C30H37N4O8S2+ |
| Molecular Weight | 645.78 g/mol |
| Exact Mass | 645.20 |
| IUPAC Name | [9-[4-[2-(carboxyamino)ethylsulfamoyl]-2-(trioxidanylsulfanyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)NCCNC(=O)O)cc3SOOO)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C30H36N4O8S2/c1-5-33(6-2)20-9-12-23-26(17-20)40-27-18-21(34(7-3)8-4)10-13-24(27)29(23)25-14-11-22(19-28(25)43-42-41-37)44(38,39)32-16-15-31-30(35)36/h9-14,17-19,31-32H,5-8,15-16H2,1-4H3,(H-,35,36,37)/p+1 |
| InChIKey | RBRUWMWGTXLEDD-UHFFFAOYSA-O |
| XLogP | 4.84 |
| TPSA | 153.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.78 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|