C40H58N3O8S2+ — CID 163462909
[6-(diethylamino)-9-[2-methyl-4-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylsulfamoyl]phenyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 163462909) has the molecular formula C40H58N3O8S2+ and a molecular weight of 773.05 g/mol. Its IUPAC name is [6-(diethylamino)-9-[2-methyl-4-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylsulfamoyl]phenyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[2-methyl-4-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylsulfamoyl]phenyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 163462909 |
| Molecular Formula | C40H58N3O8S2+ |
| Molecular Weight | 773.05 g/mol |
| Exact Mass | 772.37 |
| IUPAC Name | [6-(diethylamino)-9-[2-methyl-4-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylsulfamoyl]phenyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)NCCOCCOCCOCCOCCOCCS)cc3C)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C40H57N3O8S2/c1-6-42(7-2)32-10-13-36-38(29-32)51-39-30-33(43(8-3)9-4)11-14-37(39)40(36)35-15-12-34(28-31(35)5)53(44,45)41-16-17-46-18-19-47-20-21-48-22-23-49-24-25-50-26-27-52/h10-15,28-30,41H,6-9,16-27H2,1-5H3/p+1 |
| InChIKey | AJDYZYNUFFKKIQ-UHFFFAOYSA-O |
| XLogP | 5.46 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.05 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|