C33H45N4O6S2+ — CID 21299341
[9-[4-(6-aminohexylsulfamoyl)-2-sulfophenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 21299341) has the molecular formula C33H45N4O6S2+ and a molecular weight of 657.88 g/mol. Its IUPAC name is [9-[4-(6-aminohexylsulfamoyl)-2-sulfophenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-[4-(6-aminohexylsulfamoyl)-2-sulfophenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 21299341 |
| Molecular Formula | C33H45N4O6S2+ |
| Molecular Weight | 657.88 g/mol |
| Exact Mass | 657.28 |
| IUPAC Name | [9-[4-(6-aminohexylsulfamoyl)-2-sulfophenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)NCCCCCCN)cc3S(=O)(=O)O)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C33H44N4O6S2/c1-5-36(6-2)24-13-16-27-30(21-24)43-31-22-25(37(7-3)8-4)14-17-28(31)33(27)29-18-15-26(23-32(29)45(40,41)42)44(38,39)35-20-12-10-9-11-19-34/h13-18,21-23,35H,5-12,19-20,34H2,1-4H3/p+1 |
| InChIKey | GRJQJVNZGGPIIH-UHFFFAOYSA-O |
| XLogP | 4.91 |
| TPSA | 145.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.88 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|