C37H55N6O6S2+ — CID 45271211
[9-[2-[3-[4-(3-aminopropylamino)butylamino]propylsulfamoyl]-4-sulfophenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 45271211) has the molecular formula C37H55N6O6S2+ and a molecular weight of 744.02 g/mol. Its IUPAC name is [9-[2-[3-[4-(3-aminopropylamino)butylamino]propylsulfamoyl]-4-sulfophenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-[2-[3-[4-(3-aminopropylamino)butylamino]propylsulfamoyl]-4-sulfophenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 45271211 |
| Molecular Formula | C37H55N6O6S2+ |
| Molecular Weight | 744.02 g/mol |
| Exact Mass | 743.36 |
| IUPAC Name | [9-[2-[3-[4-(3-aminopropylamino)butylamino]propylsulfamoyl]-4-sulfophenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)O)cc3S(=O)(=O)NCCCNCCCCNCCCN)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C37H54N6O6S2/c1-5-42(6-2)28-13-16-31-34(25-28)49-35-26-29(43(7-3)8-4)14-17-32(35)37(31)33-18-15-30(51(46,47)48)27-36(33)50(44,45)41-24-12-23-40-21-10-9-20-39-22-11-19-38/h13-18,25-27,39-41H,5-12,19-24,38H2,1-4H3/p+1 |
| InChIKey | RAEZROJACHYBJU-UHFFFAOYSA-O |
| XLogP | 4.09 |
| TPSA | 170.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.02 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|