C55H57N4O4S3+ — CID 154627296
phenyl-[3-(3-phenylsulfanylpropylamino)propyl]-[6-[N-[3-(3-phenylsulfanylpropylamino)propyl]anilino]-9-(2-sulfophenyl)xanthen-3-ylidene]azanium (PubChem CID 154627296) has the molecular formula C55H57N4O4S3+ and a molecular weight of 934.29 g/mol. Its IUPAC name is phenyl-[3-(3-phenylsulfanylpropylamino)propyl]-[6-[N-[3-(3-phenylsulfanylpropylamino)propyl]anilino]-9-(2-sulfophenyl)xanthen-3-ylidene]azanium.
| Compound Name | phenyl-[3-(3-phenylsulfanylpropylamino)propyl]-[6-[N-[3-(3-phenylsulfanylpropylamino)propyl]anilino]-9-(2-sulfophenyl)xanthen-3-ylidene]azanium |
|---|---|
| PubChem CID | 154627296 |
| Molecular Formula | C55H57N4O4S3+ |
| Molecular Weight | 934.29 g/mol |
| Exact Mass | 933.35 |
| IUPAC Name | phenyl-[3-(3-phenylsulfanylpropylamino)propyl]-[6-[N-[3-(3-phenylsulfanylpropylamino)propyl]anilino]-9-(2-sulfophenyl)xanthen-3-ylidene]azanium |
| SMILES | O=S(=O)(O)c1ccccc1-c1c2cc/c(=[N+](/CCCNCCCSc3ccccc3)c3ccccc3)cc-2oc2cc(N(CCCNCCCSc3ccccc3)c3ccccc3)ccc12 |
| InChI | InChI=1S/C55H56N4O4S3/c60-66(61,62)54-28-14-13-27-51(54)55-49-31-29-45(58(43-19-5-1-6-20-43)37-15-33-56-35-17-39-64-47-23-9-3-10-24-47)41-52(49)63-53-42-46(30-32-50(53)55)59(44-21-7-2-8-22-44)38-16-34-57-36-18-40-65-48-25-11-4-12-26-48/h1-14,19-32,41-42,56-57H,15-18,33-40H2/p+1 |
| InChIKey | KYMNVTPPKNWAJK-UHFFFAOYSA-O |
| XLogP | 12.02 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.29 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|