C57H60N3O3S3+ — CID 154627139
[9-[2-(2-ethylhexylsulfamoyl)phenyl]-6-[2-methyl-N-(2-phenylsulfanylethyl)anilino]xanthen-3-ylidene]-(2-methylphenyl)-(2-phenylsulfanylethyl)azanium (PubChem CID 154627139) has the molecular formula C57H60N3O3S3+ and a molecular weight of 931.33 g/mol. Its IUPAC name is [9-[2-(2-ethylhexylsulfamoyl)phenyl]-6-[2-methyl-N-(2-phenylsulfanylethyl)anilino]xanthen-3-ylidene]-(2-methylphenyl)-(2-phenylsulfanylethyl)azanium.
| Compound Name | [9-[2-(2-ethylhexylsulfamoyl)phenyl]-6-[2-methyl-N-(2-phenylsulfanylethyl)anilino]xanthen-3-ylidene]-(2-methylphenyl)-(2-phenylsulfanylethyl)azanium |
|---|---|
| PubChem CID | 154627139 |
| Molecular Formula | C57H60N3O3S3+ |
| Molecular Weight | 931.33 g/mol |
| Exact Mass | 930.38 |
| IUPAC Name | [9-[2-(2-ethylhexylsulfamoyl)phenyl]-6-[2-methyl-N-(2-phenylsulfanylethyl)anilino]xanthen-3-ylidene]-(2-methylphenyl)-(2-phenylsulfanylethyl)azanium |
| SMILES | CCCCC(CC)CNS(=O)(=O)c1ccccc1-c1c2cc/c(=[N+](/CCSc3ccccc3)c3ccccc3C)cc-2oc2cc(N(CCSc3ccccc3)c3ccccc3C)ccc12 |
| InChI | InChI=1S/C57H60N3O3S3/c1-5-7-22-44(6-2)41-58-66(61,62)56-30-19-16-27-51(56)57-49-33-31-45(59(52-28-17-14-20-42(52)3)35-37-64-47-23-10-8-11-24-47)39-54(49)63-55-40-46(32-34-50(55)57)60(53-29-18-15-21-43(53)4)36-38-65-48-25-12-9-13-26-48/h8-21,23-34,39-40,44,58H,5-7,22,35-38,41H2,1-4H3/q+1 |
| InChIKey | KORYQGGDAUOQBZ-UHFFFAOYSA-N |
| XLogP | 14.14 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.33 |
| LogP ≤ 5 | 14.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|