C47H38N2O4S3 — CID 154627252
2-[(3Z)-3-[(2-methylphenyl)-(phenylsulfanylmethyl)azaniumylidene]-6-[2-methyl-N-(phenylsulfanylmethyl)anilino]xanthen-9-yl]benzenesulfonate (PubChem CID 154627252) has the molecular formula C47H38N2O4S3 and a molecular weight of 791.03 g/mol. Its IUPAC name is 2-[(3Z)-3-[(2-methylphenyl)-(phenylsulfanylmethyl)azaniumylidene]-6-[2-methyl-N-(phenylsulfanylmethyl)anilino]xanthen-9-yl]benzenesulfonate.
| Compound Name | 2-[(3Z)-3-[(2-methylphenyl)-(phenylsulfanylmethyl)azaniumylidene]-6-[2-methyl-N-(phenylsulfanylmethyl)anilino]xanthen-9-yl]benzenesulfonate |
|---|---|
| PubChem CID | 154627252 |
| Molecular Formula | C47H38N2O4S3 |
| Molecular Weight | 791.03 g/mol |
| Exact Mass | 790.20 |
| IUPAC Name | 2-[(3Z)-3-[(2-methylphenyl)-(phenylsulfanylmethyl)azaniumylidene]-6-[2-methyl-N-(phenylsulfanylmethyl)anilino]xanthen-9-yl]benzenesulfonate |
| SMILES | Cc1ccccc1N(CSc1ccccc1)c1ccc2c(-c3ccccc3S(=O)(=O)[O-])c3cc/c(=[N+](/CSc4ccccc4)c4ccccc4C)cc-3oc2c1 |
| InChI | InChI=1S/C47H38N2O4S3/c1-33-15-9-12-22-42(33)48(31-54-37-17-5-3-6-18-37)35-25-27-39-44(29-35)53-45-30-36(26-28-40(45)47(39)41-21-11-14-24-46(41)56(50,51)52)49(43-23-13-10-16-34(43)2)32-55-38-19-7-4-8-20-38/h3-30H,31-32H2,1-2H3 |
| InChIKey | JDMVSKRGGNVTEP-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 76.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.03 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|