C41H42N2O4S — CID 140761001
2-[3-[(2,6-dimethylphenyl)-propan-2-ylazaniumylidene]-6-(2,6-dimethyl-N-propan-2-ylanilino)xanthen-9-yl]benzenesulfonate (PubChem CID 140761001) has the molecular formula C41H42N2O4S and a molecular weight of 658.86 g/mol. Its IUPAC name is 2-[3-[(2,6-dimethylphenyl)-propan-2-ylazaniumylidene]-6-(2,6-dimethyl-N-propan-2-ylanilino)xanthen-9-yl]benzenesulfonate.
| Compound Name | 2-[3-[(2,6-dimethylphenyl)-propan-2-ylazaniumylidene]-6-(2,6-dimethyl-N-propan-2-ylanilino)xanthen-9-yl]benzenesulfonate |
|---|---|
| PubChem CID | 140761001 |
| Molecular Formula | C41H42N2O4S |
| Molecular Weight | 658.86 g/mol |
| Exact Mass | 658.29 |
| IUPAC Name | 2-[3-[(2,6-dimethylphenyl)-propan-2-ylazaniumylidene]-6-(2,6-dimethyl-N-propan-2-ylanilino)xanthen-9-yl]benzenesulfonate |
| SMILES | Cc1cccc(C)c1N(c1ccc2c(-c3ccccc3S(=O)(=O)[O-])c3cc/c(=[N+](\c4c(C)cccc4C)C(C)C)cc-3oc2c1)C(C)C |
| InChI | InChI=1S/C41H42N2O4S/c1-25(2)42(40-27(5)13-11-14-28(40)6)31-19-21-33-36(23-31)47-37-24-32(43(26(3)4)41-29(7)15-12-16-30(41)8)20-22-34(37)39(33)35-17-9-10-18-38(35)48(44,45)46/h9-26H,1-8H3 |
| InChIKey | KLGHXGYFHMPDIZ-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 76.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.86 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|