C30H38N2O8SSi — CID 164776762
2-[(6E)-3-(diethylamino)-6-[methyl(2-trimethoxysilylethoxymethyl)azaniumylidene]xanthen-9-yl]benzenesulfonate (PubChem CID 164776762) has the molecular formula C30H38N2O8SSi and a molecular weight of 614.79 g/mol. Its IUPAC name is 2-[(6E)-3-(diethylamino)-6-[methyl(2-trimethoxysilylethoxymethyl)azaniumylidene]xanthen-9-yl]benzenesulfonate.
| Compound Name | 2-[(6E)-3-(diethylamino)-6-[methyl(2-trimethoxysilylethoxymethyl)azaniumylidene]xanthen-9-yl]benzenesulfonate |
|---|---|
| PubChem CID | 164776762 |
| Molecular Formula | C30H38N2O8SSi |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | 2-[(6E)-3-(diethylamino)-6-[methyl(2-trimethoxysilylethoxymethyl)azaniumylidene]xanthen-9-yl]benzenesulfonate |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3S(=O)(=O)[O-])c3cc/c(=[N+](/C)COCC[Si](OC)(OC)OC)cc-3oc2c1 |
| InChI | InChI=1S/C30H38N2O8SSi/c1-7-32(8-2)23-14-16-25-28(20-23)40-27-19-22(31(3)21-39-17-18-42(36-4,37-5)38-6)13-15-24(27)30(25)26-11-9-10-12-29(26)41(33,34)35/h9-16,19-20H,7-8,17-18,21H2,1-6H3 |
| InChIKey | AYBYPLPRPIUHBE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 113.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|