C34H29As2N2O9+ — CID 59467539
[6-(4-arsono-N-methylanilino)-9-(2-carboxyphenyl)xanthen-3-ylidene]-(4-arsonophenyl)-methylazanium (PubChem CID 59467539) has the molecular formula C34H29As2N2O9+ and a molecular weight of 759.46 g/mol. Its IUPAC name is [6-(4-arsono-N-methylanilino)-9-(2-carboxyphenyl)xanthen-3-ylidene]-(4-arsonophenyl)-methylazanium.
| Compound Name | [6-(4-arsono-N-methylanilino)-9-(2-carboxyphenyl)xanthen-3-ylidene]-(4-arsonophenyl)-methylazanium |
|---|---|
| PubChem CID | 59467539 |
| Molecular Formula | C34H29As2N2O9+ |
| Molecular Weight | 759.46 g/mol |
| Exact Mass | 759.03 |
| IUPAC Name | [6-(4-arsono-N-methylanilino)-9-(2-carboxyphenyl)xanthen-3-ylidene]-(4-arsonophenyl)-methylazanium |
| SMILES | CN(c1ccc([As](=O)(O)O)cc1)c1ccc2c(-c3ccccc3C(=O)O)c3cc/c(=[N+](/C)c4ccc([As](=O)(O)O)cc4)cc-3oc2c1 |
| InChI | InChI=1S/C34H28As2N2O9/c1-37(23-11-7-21(8-12-23)35(41,42)43)25-15-17-29-31(19-25)47-32-20-26(38(2)24-13-9-22(10-14-24)36(44,45)46)16-18-30(32)33(29)27-5-3-4-6-28(27)34(39)40/h3-20H,1-2H3,(H4-,39,40,41,42,43,44,45,46)/p+1 |
| InChIKey | APJBQHCDIVLZSY-UHFFFAOYSA-O |
| XLogP | 2.53 |
| TPSA | 171.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|