C42H31N2O3+ — CID 166491657
[13-(2-carboxyphenyl)-19-(N-methylanilino)-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3,5,8,10,12,15,17(22),18,20-decaen-7-ylidene]-methyl-phenylazanium (PubChem CID 166491657) has the molecular formula C42H31N2O3+ and a molecular weight of 611.72 g/mol. Its IUPAC name is [13-(2-carboxyphenyl)-19-(N-methylanilino)-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3,5,8,10,12,15,17(22),18,20-decaen-7-ylidene]-methyl-phenylazanium.
| Compound Name | [13-(2-carboxyphenyl)-19-(N-methylanilino)-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3,5,8,10,12,15,17(22),18,20-decaen-7-ylidene]-methyl-phenylazanium |
|---|---|
| PubChem CID | 166491657 |
| Molecular Formula | C42H31N2O3+ |
| Molecular Weight | 611.72 g/mol |
| Exact Mass | 611.23 |
| IUPAC Name | [13-(2-carboxyphenyl)-19-(N-methylanilino)-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3,5,8,10,12,15,17(22),18,20-decaen-7-ylidene]-methyl-phenylazanium |
| SMILES | CN(c1ccccc1)c1ccc2c(ccc3c(-c4ccccc4C(=O)O)c4ccc5c/c(=[N+](/C)c6ccccc6)ccc5c4oc32)c1 |
| InChI | InChI=1S/C42H30N2O3/c1-43(29-11-5-3-6-12-29)31-19-23-33-27(25-31)17-21-37-39(35-15-9-10-16-36(35)42(45)46)38-22-18-28-26-32(44(2)30-13-7-4-8-14-30)20-24-34(28)41(38)47-40(33)37/h3-26H,1-2H3/p+1 |
| InChIKey | GIMYXMHALKFWGS-UHFFFAOYSA-O |
| XLogP | 9.76 |
| TPSA | 56.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.72 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|