C27H19NO6 — CID 14944479
3-[10-(dimethylamino)-3-oxobenzo[c]xanthen-7-yl]phthalic acid (PubChem CID 14944479) has the molecular formula C27H19NO6 and a molecular weight of 453.45 g/mol. Its IUPAC name is 3-[10-(dimethylamino)-3-oxobenzo[c]xanthen-7-yl]phthalic acid.
| Compound Name | 3-[10-(dimethylamino)-3-oxobenzo[c]xanthen-7-yl]phthalic acid |
|---|---|
| PubChem CID | 14944479 |
| Molecular Formula | C27H19NO6 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 3-[10-(dimethylamino)-3-oxobenzo[c]xanthen-7-yl]phthalic acid |
| SMILES | CN(C)c1ccc2c(-c3cccc(C(=O)O)c3C(=O)O)c3ccc4cc(=O)ccc4c3oc2c1 |
| InChI | InChI=1S/C27H19NO6/c1-28(2)15-7-10-18-22(13-15)34-25-17-11-8-16(29)12-14(17)6-9-20(25)23(18)19-4-3-5-21(26(30)31)24(19)27(32)33/h3-13H,1-2H3,(H,30,31)(H,32,33) |
| InChIKey | KXMANOOVEUHESO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|