C29H20N2O3 — CID 71487554
methyl 2-(7-amino-21-imino-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(22),3(12),4(9),5,7,10,13,15,17,19-decaen-13-yl)benzoate (PubChem CID 71487554) has the molecular formula C29H20N2O3 and a molecular weight of 444.49 g/mol. Its IUPAC name is methyl 2-(7-amino-21-imino-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(22),3(12),4(9),5,7,10,13,15,17,19-decaen-13-yl)benzoate.
| Compound Name | methyl 2-(7-amino-21-imino-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(22),3(12),4(9),5,7,10,13,15,17,19-decaen-13-yl)benzoate |
|---|---|
| PubChem CID | 71487554 |
| Molecular Formula | C29H20N2O3 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | methyl 2-(7-amino-21-imino-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(22),3(12),4(9),5,7,10,13,15,17,19-decaen-13-yl)benzoate |
| SMILES | [H]/N=c1\cccc2ccc3c(-c4ccccc4C(=O)OC)c4ccc5cc(N)ccc5c4oc3c12 |
| InChI | InChI=1S/C29H20N2O3/c1-33-29(32)21-7-3-2-6-20(21)26-22-13-10-17-15-18(30)11-14-19(17)27(22)34-28-23(26)12-9-16-5-4-8-24(31)25(16)28/h2-15,31H,30H2,1H3/b31-24+ |
| InChIKey | BNBDUFGXEQETBF-QFMPWRQOSA-N |
| XLogP | 6.41 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|