About methyl 3-aminonaphthalene-1-carboxylate;methyl 3-chloronaphthalene-1-carboxylate
methyl 3-aminonaphthalene-1-carboxylate;methyl 3-chloronaphthalene-1-carboxylate (PubChem CID 159342041) has the molecular formula C24H20ClNO4
and a molecular weight of 421.88 g/mol. Its IUPAC name is methyl 3-aminonaphthalene-1-carboxylate;methyl 3-chloronaphthalene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 3-aminonaphthalene-1-carboxylate;methyl 3-chloronaphthalene-1-carboxylate |
| PubChem CID | 159342041 |
| Molecular Formula | C24H20ClNO4 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | methyl 3-aminonaphthalene-1-carboxylate;methyl 3-chloronaphthalene-1-carboxylate |
| SMILES | COC(=O)c1cc(Cl)cc2ccccc12.COC(=O)c1cc(N)cc2ccccc12 |
| InChI | InChI=1S/C12H9ClO2.C12H11NO2/c2*1-15-12(14)11-7-9(13)6-8-4-2-3-5-10(8)11/h2-7H,1H3;2-7H,13H2,1H3 |
| InChIKey | LGGIQEAXRKCDGH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-aminonaphthalene-1-carboxylate;methyl 3-chloronaphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-aminonaphthalene-1-carboxylate;methyl 3-chloronaphthalene-1-carboxylate?
The IUPAC name of methyl 3-aminonaphthalene-1-carboxylate;methyl 3-chloronaphthalene-1-carboxylate (CID 159342041) is methyl 3-aminonaphthalene-1-carboxylate;methyl 3-chloronaphthalene-1-carboxylate.
What is the SMILES notation for methyl 3-aminonaphthalene-1-carboxylate;methyl 3-chloronaphthalene-1-carboxylate?
The canonical SMILES for methyl 3-aminonaphthalene-1-carboxylate;methyl 3-chloronaphthalene-1-carboxylate is COC(=O)c1cc(Cl)cc2ccccc12.COC(=O)c1cc(N)cc2ccccc12.
What is the InChIKey of methyl 3-aminonaphthalene-1-carboxylate;methyl 3-chloronaphthalene-1-carboxylate?
The InChIKey is LGGIQEAXRKCDGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClO2.C12H11NO2/c2*1-15-12(14)11-7-9(13)6-8-4-2-3-5-10(8)11/h2-7H,1H3;2-7H,13H2,1H3.
What are the key properties of methyl 3-aminonaphthalene-1-carboxylate;methyl 3-chloronaphthalene-1-carboxylate?
methyl 3-aminonaphthalene-1-carboxylate;methyl 3-chloronaphthalene-1-carboxylate has a molecular weight of 421.88 g/mol, XLogP of 5.49, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-aminonaphthalene-1-carboxylate;methyl 3-chloronaphthalene-1-carboxylate is sourced from PubChem (CID 159342041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).