C26H28N2O9S2 — CID 153394194
3-amino-6-imino-9-(2-methoxycarbonyl-5-propan-2-ylphenyl)xanthene-4,5-disulfonic acid;ethane (PubChem CID 153394194) has the molecular formula C26H28N2O9S2 and a molecular weight of 576.65 g/mol. Its IUPAC name is 3-amino-6-imino-9-(2-methoxycarbonyl-5-propan-2-ylphenyl)xanthene-4,5-disulfonic acid;ethane.
| Compound Name | 3-amino-6-imino-9-(2-methoxycarbonyl-5-propan-2-ylphenyl)xanthene-4,5-disulfonic acid;ethane |
|---|---|
| PubChem CID | 153394194 |
| Molecular Formula | C26H28N2O9S2 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.12 |
| IUPAC Name | 3-amino-6-imino-9-(2-methoxycarbonyl-5-propan-2-ylphenyl)xanthene-4,5-disulfonic acid;ethane |
| SMILES | CC.[H]/N=c1\ccc2c(-c3cc(C(C)C)ccc3C(=O)OC)c3ccc(N)c(S(=O)(=O)O)c3oc-2c1S(=O)(=O)O |
| InChI | InChI=1S/C24H22N2O9S2.C2H6/c1-11(2)12-4-5-13(24(27)34-3)16(10-12)19-14-6-8-17(25)22(36(28,29)30)20(14)35-21-15(19)7-9-18(26)23(21)37(31,32)33;1-2/h4-11,25H,26H2,1-3H3,(H,28,29,30)(H,31,32,33);1-2H3/b25-17+; |
| InChIKey | AJBIRTHRUKRDFO-AREUYOMRSA-N |
| XLogP | 4.70 |
| TPSA | 198.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|