C26H19N3O13S3 — CID 146622205
2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-5-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]-4-sulfanylbenzoic acid (PubChem CID 146622205) has the molecular formula C26H19N3O13S3 and a molecular weight of 677.65 g/mol. Its IUPAC name is 2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-5-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]-4-sulfanylbenzoic acid.
| Compound Name | 2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-5-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]-4-sulfanylbenzoic acid |
|---|---|
| PubChem CID | 146622205 |
| Molecular Formula | C26H19N3O13S3 |
| Molecular Weight | 677.65 g/mol |
| Exact Mass | 677.01 |
| IUPAC Name | 2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-5-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]-4-sulfanylbenzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3cc(S)c(CC(=O)ON4C(=O)CCC4=O)cc3C(=O)O)c3ccc(N)c(S(=O)(=O)O)c3oc-2c1S(=O)(=O)O |
| InChI | InChI=1S/C26H19N3O13S3/c27-15-3-1-11-21(12-2-4-16(28)25(45(38,39)40)23(12)41-22(11)24(15)44(35,36)37)13-9-17(43)10(7-14(13)26(33)34)8-20(32)42-29-18(30)5-6-19(29)31/h1-4,7,9,27,43H,5-6,8,28H2,(H,33,34)(H,35,36,37)(H,38,39,40)/b27-15+ |
| InChIKey | KSTROLCKBYCFRV-JFLMPSFJSA-N |
| XLogP | 1.90 |
| TPSA | 272.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.65 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|