C25H21NO10S2 — CID 157253483
2-(3-imino-6-methyl-4,5-disulfoxanthen-9-yl)-4-(2-methylpropanoyl)benzoic acid (PubChem CID 157253483) has the molecular formula C25H21NO10S2 and a molecular weight of 559.57 g/mol. Its IUPAC name is 2-(3-imino-6-methyl-4,5-disulfoxanthen-9-yl)-4-(2-methylpropanoyl)benzoic acid.
| Compound Name | 2-(3-imino-6-methyl-4,5-disulfoxanthen-9-yl)-4-(2-methylpropanoyl)benzoic acid |
|---|---|
| PubChem CID | 157253483 |
| Molecular Formula | C25H21NO10S2 |
| Molecular Weight | 559.57 g/mol |
| Exact Mass | 559.06 |
| IUPAC Name | 2-(3-imino-6-methyl-4,5-disulfoxanthen-9-yl)-4-(2-methylpropanoyl)benzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3cc(C(=O)C(C)C)ccc3C(=O)O)c3ccc(C)c(S(=O)(=O)O)c3oc-2c1S(=O)(=O)O |
| InChI | InChI=1S/C25H21NO10S2/c1-11(2)20(27)13-5-7-14(25(28)29)17(10-13)19-15-6-4-12(3)23(37(30,31)32)21(15)36-22-16(19)8-9-18(26)24(22)38(33,34)35/h4-11,26H,1-3H3,(H,28,29)(H,30,31,32)(H,33,34,35)/b26-18+ |
| InChIKey | GJKKIIOMBFYPSN-NLRVBDNBSA-N |
| XLogP | 4.02 |
| TPSA | 200.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|