C22H16N2O11S2 — CID 23543053
2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-4-methoxycarbonylbenzoic acid (PubChem CID 23543053) has the molecular formula C22H16N2O11S2 and a molecular weight of 548.51 g/mol. Its IUPAC name is 2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-4-methoxycarbonylbenzoic acid.
| Compound Name | 2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-4-methoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 23543053 |
| Molecular Formula | C22H16N2O11S2 |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 548.02 |
| IUPAC Name | 2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-4-methoxycarbonylbenzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3cc(C(=O)OC)ccc3C(=O)O)c3ccc(N)c(S(=O)(=O)O)c3oc-2c1S(=O)(=O)O |
| InChI | InChI=1S/C22H16N2O11S2/c1-34-22(27)9-2-3-10(21(25)26)13(8-9)16-11-4-6-14(23)19(36(28,29)30)17(11)35-18-12(16)5-7-15(24)20(18)37(31,32)33/h2-8,23H,24H2,1H3,(H,25,26)(H,28,29,30)(H,31,32,33)/b23-14+ |
| InChIKey | IAJALXQOLMZNMU-OEAKJJBVSA-N |
| XLogP | 2.24 |
| TPSA | 235.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|