C25H22N2O11S2 — CID 178093750
3-amino-6-imino-9-[2-methylperoxycarbonyl-4-(2-methylpropanoyl)phenyl]xanthene-4,5-disulfonic acid (PubChem CID 178093750) has the molecular formula C25H22N2O11S2 and a molecular weight of 590.59 g/mol. Its IUPAC name is 3-amino-6-imino-9-[2-methylperoxycarbonyl-4-(2-methylpropanoyl)phenyl]xanthene-4,5-disulfonic acid.
| Compound Name | 3-amino-6-imino-9-[2-methylperoxycarbonyl-4-(2-methylpropanoyl)phenyl]xanthene-4,5-disulfonic acid |
|---|---|
| PubChem CID | 178093750 |
| Molecular Formula | C25H22N2O11S2 |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 590.07 |
| IUPAC Name | 3-amino-6-imino-9-[2-methylperoxycarbonyl-4-(2-methylpropanoyl)phenyl]xanthene-4,5-disulfonic acid |
| SMILES | [H]/N=c1\ccc2c(-c3ccc(C(=O)C(C)C)cc3C(=O)OOC)c3ccc(N)c(S(=O)(=O)O)c3oc-2c1S(=O)(=O)O |
| InChI | InChI=1S/C25H22N2O11S2/c1-11(2)20(28)12-4-5-13(16(10-12)25(29)38-36-3)19-14-6-8-17(26)23(39(30,31)32)21(14)37-22-15(19)7-9-18(27)24(22)40(33,34)35/h4-11,26H,27H2,1-3H3,(H,30,31,32)(H,33,34,35)/b26-17+ |
| InChIKey | AWXHOQKQYNXJKK-YZSQISJMSA-N |
| XLogP | 3.32 |
| TPSA | 224.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|